About 2-oxothiane-3-carboxylic acid
2-oxothiane-3-carboxylic acid (PubChem CID 135172301) has the molecular formula C6H8O3S
and a molecular weight of 160.19 g/mol. Its IUPAC name is 2-oxothiane-3-carboxylic acid.
Molecular Properties
| Compound Name | 2-oxothiane-3-carboxylic acid |
| PubChem CID | 135172301 |
| Molecular Formula | C6H8O3S |
| Molecular Weight | 160.19 g/mol |
| Exact Mass | 160.02 |
| IUPAC Name | 2-oxothiane-3-carboxylic acid |
| SMILES | O=C(O)C1CCCSC1=O |
| InChI | InChI=1S/C6H8O3S/c7-5(8)4-2-1-3-10-6(4)9/h4H,1-3H2,(H,7,8) |
| InChIKey | APCIHSJHLYXZDC-UHFFFAOYSA-N |
| XLogP | 0.74 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 160.19 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|
Analyze 2-oxothiane-3-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-oxothiane-3-carboxylic acid?
The IUPAC name of 2-oxothiane-3-carboxylic acid (CID 135172301) is 2-oxothiane-3-carboxylic acid.
What is the SMILES notation for 2-oxothiane-3-carboxylic acid?
The canonical SMILES for 2-oxothiane-3-carboxylic acid is O=C(O)C1CCCSC1=O.
What is the InChIKey of 2-oxothiane-3-carboxylic acid?
The InChIKey is APCIHSJHLYXZDC-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H8O3S/c7-5(8)4-2-1-3-10-6(4)9/h4H,1-3H2,(H,7,8).
What are the key properties of 2-oxothiane-3-carboxylic acid?
2-oxothiane-3-carboxylic acid has a molecular weight of 160.19 g/mol, XLogP of 0.74, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-oxothiane-3-carboxylic acid is sourced from PubChem (CID 135172301), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).