C22H48N2 — CID 135172442
4-ethyl-N'-hexyl-N'-methyl-N,N-dipropylheptane-1,7-diamine (PubChem CID 135172442) has the molecular formula C22H48N2 and a molecular weight of 340.64 g/mol. Its IUPAC name is 4-ethyl-N'-hexyl-N'-methyl-N,N-dipropylheptane-1,7-diamine.
| Compound Name | 4-ethyl-N'-hexyl-N'-methyl-N,N-dipropylheptane-1,7-diamine |
|---|---|
| PubChem CID | 135172442 |
| Molecular Formula | C22H48N2 |
| Molecular Weight | 340.64 g/mol |
| Exact Mass | 340.38 |
| IUPAC Name | 4-ethyl-N'-hexyl-N'-methyl-N,N-dipropylheptane-1,7-diamine |
| SMILES | CCCCCCN(C)CCCC(CC)CCCN(CCC)CCC |
| InChI | InChI=1S/C22H48N2/c1-6-10-11-12-19-23(5)20-13-15-22(9-4)16-14-21-24(17-7-2)18-8-3/h22H,6-21H2,1-5H3 |
| InChIKey | CGWPZGOEFZVRAO-UHFFFAOYSA-N |
| XLogP | 6.21 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.64 |
| LogP ≤ 5 | 6.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|