About 5-N-butyl-6-methyl-1,4-dihydropyrimidine-4,5-diamine
5-N-butyl-6-methyl-1,4-dihydropyrimidine-4,5-diamine (PubChem CID 135172663) has the molecular formula C9H18N4
and a molecular weight of 182.27 g/mol. Its IUPAC name is 5-N-butyl-6-methyl-1,4-dihydropyrimidine-4,5-diamine.
Molecular Properties
| Compound Name | 5-N-butyl-6-methyl-1,4-dihydropyrimidine-4,5-diamine |
| PubChem CID | 135172663 |
| Molecular Formula | C9H18N4 |
| Molecular Weight | 182.27 g/mol |
| Exact Mass | 182.15 |
| IUPAC Name | 5-N-butyl-6-methyl-1,4-dihydropyrimidine-4,5-diamine |
| SMILES | CCCCNC1=C(C)NC=NC1N |
| InChI | InChI=1S/C9H18N4/c1-3-4-5-11-8-7(2)12-6-13-9(8)10/h6,9,11H,3-5,10H2,1-2H3,(H,12,13) |
| InChIKey | VZYXVJNRMRWHHG-UHFFFAOYSA-N |
| XLogP | 0.52 |
| TPSA | 62.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 182.27 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 5-N-butyl-6-methyl-1,4-dihydropyrimidine-4,5-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-N-butyl-6-methyl-1,4-dihydropyrimidine-4,5-diamine?
The IUPAC name of 5-N-butyl-6-methyl-1,4-dihydropyrimidine-4,5-diamine (CID 135172663) is 5-N-butyl-6-methyl-1,4-dihydropyrimidine-4,5-diamine.
What is the SMILES notation for 5-N-butyl-6-methyl-1,4-dihydropyrimidine-4,5-diamine?
The canonical SMILES for 5-N-butyl-6-methyl-1,4-dihydropyrimidine-4,5-diamine is CCCCNC1=C(C)NC=NC1N.
What is the InChIKey of 5-N-butyl-6-methyl-1,4-dihydropyrimidine-4,5-diamine?
The InChIKey is VZYXVJNRMRWHHG-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H18N4/c1-3-4-5-11-8-7(2)12-6-13-9(8)10/h6,9,11H,3-5,10H2,1-2H3,(H,12,13).
What are the key properties of 5-N-butyl-6-methyl-1,4-dihydropyrimidine-4,5-diamine?
5-N-butyl-6-methyl-1,4-dihydropyrimidine-4,5-diamine has a molecular weight of 182.27 g/mol, XLogP of 0.52, 4 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-N-butyl-6-methyl-1,4-dihydropyrimidine-4,5-diamine is sourced from PubChem (CID 135172663), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).