C30H28N2O6 — CID 135172897
3'-methylidene-1-[6-(4'-methylidene-2,5'-dioxospiro[indole-3,2'-oxolane]-1-yl)hexyl]spiro[indole-3,5'-oxolane]-2,2'-dione (PubChem CID 135172897) has the molecular formula C30H28N2O6 and a molecular weight of 512.56 g/mol. Its IUPAC name is 3'-methylidene-1-[6-(4'-methylidene-2,5'-dioxospiro[indole-3,2'-oxolane]-1-yl)hexyl]spiro[indole-3,5'-oxolane]-2,2'-dione.
| Compound Name | 3'-methylidene-1-[6-(4'-methylidene-2,5'-dioxospiro[indole-3,2'-oxolane]-1-yl)hexyl]spiro[indole-3,5'-oxolane]-2,2'-dione |
|---|---|
| PubChem CID | 135172897 |
| Molecular Formula | C30H28N2O6 |
| Molecular Weight | 512.56 g/mol |
| Exact Mass | 512.19 |
| IUPAC Name | 3'-methylidene-1-[6-(4'-methylidene-2,5'-dioxospiro[indole-3,2'-oxolane]-1-yl)hexyl]spiro[indole-3,5'-oxolane]-2,2'-dione |
| SMILES | C=C1CC2(OC1=O)C(=O)N(CCCCCCN1C(=O)C3(CC(=C)C(=O)O3)c3ccccc31)c1ccccc12 |
| InChI | InChI=1S/C30H28N2O6/c1-19-17-29(37-25(19)33)21-11-5-7-13-23(21)31(27(29)35)15-9-3-4-10-16-32-24-14-8-6-12-22(24)30(28(32)36)18-20(2)26(34)38-30/h5-8,11-14H,1-4,9-10,15-18H2 |
| InChIKey | AFKSRWCHKUSNJZ-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 93.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.56 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|