C60H42O2 — CID 135173030
4-[3-[3-(4-hydroxyphenyl)-2,4,5-triphenylphenyl]-2,5,6-triphenylphenyl]phenol (PubChem CID 135173030) has the molecular formula C60H42O2 and a molecular weight of 794.99 g/mol. Its IUPAC name is 4-[3-[3-(4-hydroxyphenyl)-2,4,5-triphenylphenyl]-2,5,6-triphenylphenyl]phenol.
| Compound Name | 4-[3-[3-(4-hydroxyphenyl)-2,4,5-triphenylphenyl]-2,5,6-triphenylphenyl]phenol |
|---|---|
| PubChem CID | 135173030 |
| Molecular Formula | C60H42O2 |
| Molecular Weight | 794.99 g/mol |
| Exact Mass | 794.32 |
| IUPAC Name | 4-[3-[3-(4-hydroxyphenyl)-2,4,5-triphenylphenyl]-2,5,6-triphenylphenyl]phenol |
| SMILES | Oc1ccc(-c2c(-c3ccccc3)c(-c3ccccc3)cc(-c3cc(-c4ccccc4)c(-c4ccccc4)c(-c4ccc(O)cc4)c3-c3ccccc3)c2-c2ccccc2)cc1 |
| InChI | InChI=1S/C60H42O2/c61-49-35-31-47(32-36-49)59-55(43-23-11-3-12-24-43)51(41-19-7-1-8-20-41)39-53(57(59)45-27-15-5-16-28-45)54-40-52(42-21-9-2-10-22-42)56(44-25-13-4-14-26-44)60(48-33-37-50(62)38-34-48)58(54)46-29-17-6-18-30-46/h1-40,61-62H |
| InChIKey | PHAKJNAELGYXSQ-UHFFFAOYSA-N |
| XLogP | 16.10 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 62 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 794.99 |
| LogP ≤ 5 | 16.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |