C13H29NO5 — CID 135173496
1-[2-[2-[2-(methylamino)ethoxy]ethoxy]ethoxy]-3-propan-2-yloxypropan-2-ol (PubChem CID 135173496) has the molecular formula C13H29NO5 and a molecular weight of 279.38 g/mol. Its IUPAC name is 1-[2-[2-[2-(methylamino)ethoxy]ethoxy]ethoxy]-3-propan-2-yloxypropan-2-ol.
| Compound Name | 1-[2-[2-[2-(methylamino)ethoxy]ethoxy]ethoxy]-3-propan-2-yloxypropan-2-ol |
|---|---|
| PubChem CID | 135173496 |
| Molecular Formula | C13H29NO5 |
| Molecular Weight | 279.38 g/mol |
| Exact Mass | 279.20 |
| IUPAC Name | 1-[2-[2-[2-(methylamino)ethoxy]ethoxy]ethoxy]-3-propan-2-yloxypropan-2-ol |
| SMILES | CNCCOCCOCCOCC(O)COC(C)C |
| InChI | InChI=1S/C13H29NO5/c1-12(2)19-11-13(15)10-18-9-8-17-7-6-16-5-4-14-3/h12-15H,4-11H2,1-3H3 |
| InChIKey | HXKRIHPUWPVCMT-UHFFFAOYSA-N |
| XLogP | 0.04 |
| TPSA | 69.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.38 |
| LogP ≤ 5 | 0.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|