About (Z)-N-(2,6-dioxopiperidin-3-yl)-2-ethenyliminopent-3-enamide
(Z)-N-(2,6-dioxopiperidin-3-yl)-2-ethenyliminopent-3-enamide (PubChem CID 135173846) has the molecular formula C12H15N3O3
and a molecular weight of 249.27 g/mol. Its IUPAC name is (Z)-N-(2,6-dioxopiperidin-3-yl)-2-ethenyliminopent-3-enamide.
Molecular Properties
| Compound Name | (Z)-N-(2,6-dioxopiperidin-3-yl)-2-ethenyliminopent-3-enamide |
| PubChem CID | 135173846 |
| Molecular Formula | C12H15N3O3 |
| Molecular Weight | 249.27 g/mol |
| Exact Mass | 249.11 |
| IUPAC Name | (Z)-N-(2,6-dioxopiperidin-3-yl)-2-ethenyliminopent-3-enamide |
| SMILES | C=C/N=C(\C=C/C)C(=O)NC1CCC(=O)NC1=O |
| InChI | InChI=1S/C12H15N3O3/c1-3-5-8(13-4-2)11(17)14-9-6-7-10(16)15-12(9)18/h3-5,9H,2,6-7H2,1H3,(H,14,17)(H,15,16,18)/b5-3-,13-8+ |
| InChIKey | WOEGPEABDGFVJC-DBIRYOJSSA-N |
| XLogP | 0.07 |
| TPSA | 87.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 249.27 |
| LogP ≤ 5 | 0.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze (Z)-N-(2,6-dioxopiperidin-3-yl)-2-ethenyliminopent-3-enamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-N-(2,6-dioxopiperidin-3-yl)-2-ethenyliminopent-3-enamide?
The IUPAC name of (Z)-N-(2,6-dioxopiperidin-3-yl)-2-ethenyliminopent-3-enamide (CID 135173846) is (Z)-N-(2,6-dioxopiperidin-3-yl)-2-ethenyliminopent-3-enamide.
What is the SMILES notation for (Z)-N-(2,6-dioxopiperidin-3-yl)-2-ethenyliminopent-3-enamide?
The canonical SMILES for (Z)-N-(2,6-dioxopiperidin-3-yl)-2-ethenyliminopent-3-enamide is C=C/N=C(\C=C/C)C(=O)NC1CCC(=O)NC1=O.
What is the InChIKey of (Z)-N-(2,6-dioxopiperidin-3-yl)-2-ethenyliminopent-3-enamide?
The InChIKey is WOEGPEABDGFVJC-DBIRYOJSSA-N. The full InChI is InChI=1S/C12H15N3O3/c1-3-5-8(13-4-2)11(17)14-9-6-7-10(16)15-12(9)18/h3-5,9H,2,6-7H2,1H3,(H,14,17)(H,15,16,18)/b5-3-,13-8+.
What are the key properties of (Z)-N-(2,6-dioxopiperidin-3-yl)-2-ethenyliminopent-3-enamide?
(Z)-N-(2,6-dioxopiperidin-3-yl)-2-ethenyliminopent-3-enamide has a molecular weight of 249.27 g/mol, XLogP of 0.07, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-N-(2,6-dioxopiperidin-3-yl)-2-ethenyliminopent-3-enamide is sourced from PubChem (CID 135173846), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).