C9H8F2O2 — CID 135173921
4-[(1Z)-buta-1,3-dienyl]-5-ethenyl-2,2-difluoro-1,3-dioxole (PubChem CID 135173921) has the molecular formula C9H8F2O2 and a molecular weight of 186.16 g/mol. Its IUPAC name is 4-[(1Z)-buta-1,3-dienyl]-5-ethenyl-2,2-difluoro-1,3-dioxole.
| Compound Name | 4-[(1Z)-buta-1,3-dienyl]-5-ethenyl-2,2-difluoro-1,3-dioxole |
|---|---|
| PubChem CID | 135173921 |
| Molecular Formula | C9H8F2O2 |
| Molecular Weight | 186.16 g/mol |
| Exact Mass | 186.05 |
| IUPAC Name | 4-[(1Z)-buta-1,3-dienyl]-5-ethenyl-2,2-difluoro-1,3-dioxole |
| SMILES | C=C/C=C\C1=C(C=C)OC(F)(F)O1 |
| InChI | InChI=1S/C9H8F2O2/c1-3-5-6-8-7(4-2)12-9(10,11)13-8/h3-6H,1-2H2/b6-5- |
| InChIKey | NQKADZATUUWJKV-WAYWQWQTSA-N |
| XLogP | 2.72 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.16 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|