C14H23NO2 — CID 135174415
(3S,4R)-4-[(3E,5E)-6-methoxyhepta-1,3,5-trien-3-yl]oxy-3-methylpiperidine (PubChem CID 135174415) has the molecular formula C14H23NO2 and a molecular weight of 237.34 g/mol. Its IUPAC name is (3S,4R)-4-[(3E,5E)-6-methoxyhepta-1,3,5-trien-3-yl]oxy-3-methylpiperidine.
| Compound Name | (3S,4R)-4-[(3E,5E)-6-methoxyhepta-1,3,5-trien-3-yl]oxy-3-methylpiperidine |
|---|---|
| PubChem CID | 135174415 |
| Molecular Formula | C14H23NO2 |
| Molecular Weight | 237.34 g/mol |
| Exact Mass | 237.17 |
| IUPAC Name | (3S,4R)-4-[(3E,5E)-6-methoxyhepta-1,3,5-trien-3-yl]oxy-3-methylpiperidine |
| SMILES | C=C/C(=C\C=C(/C)OC)O[C@@H]1CCNC[C@@H]1C |
| InChI | InChI=1S/C14H23NO2/c1-5-13(7-6-12(3)16-4)17-14-8-9-15-10-11(14)2/h5-7,11,14-15H,1,8-10H2,2-4H3/b12-6+,13-7+/t11-,14+/m0/s1 |
| InChIKey | KCEKXORLVKNOHP-WPUUADEVSA-N |
| XLogP | 2.62 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.34 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|