C16H25ClN2O3 — CID 135174542
(3aR,7aS)-3-(2-chloroethyl)-7a-[(1S)-1-hydroxy-2-methylpropyl]-1-methyl-4-(methylideneamino)-3a,4,5,6-tetrahydro-3H-indole-2,7-dione (PubChem CID 135174542) has the molecular formula C16H25ClN2O3 and a molecular weight of 328.84 g/mol. Its IUPAC name is (3aR,7aS)-3-(2-chloroethyl)-7a-[(1S)-1-hydroxy-2-methylpropyl]-1-methyl-4-(methylideneamino)-3a,4,5,6-tetrahydro-3H-indole-2,7-dione.
| Compound Name | (3aR,7aS)-3-(2-chloroethyl)-7a-[(1S)-1-hydroxy-2-methylpropyl]-1-methyl-4-(methylideneamino)-3a,4,5,6-tetrahydro-3H-indole-2,7-dione |
|---|---|
| PubChem CID | 135174542 |
| Molecular Formula | C16H25ClN2O3 |
| Molecular Weight | 328.84 g/mol |
| Exact Mass | 328.16 |
| IUPAC Name | (3aR,7aS)-3-(2-chloroethyl)-7a-[(1S)-1-hydroxy-2-methylpropyl]-1-methyl-4-(methylideneamino)-3a,4,5,6-tetrahydro-3H-indole-2,7-dione |
| SMILES | C=NC1CCC(=O)[C@@]2([C@@H](O)C(C)C)[C@@H]1C(CCCl)C(=O)N2C |
| InChI | InChI=1S/C16H25ClN2O3/c1-9(2)14(21)16-12(20)6-5-11(18-3)13(16)10(7-8-17)15(22)19(16)4/h9-11,13-14,21H,3,5-8H2,1-2,4H3/t10?,11?,13-,14+,16+/m1/s1 |
| InChIKey | GGBUWLJMJCYKGH-QRFABPOCSA-N |
| XLogP | 1.51 |
| TPSA | 69.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.84 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|