C19H33NO — CID 135174820
N-[2-[(2E,4E,6E)-5-ethenyl-8,8-dimethylnona-2,4,6-trien-3-yl]oxyethyl]-2-methylpropan-2-amine (PubChem CID 135174820) has the molecular formula C19H33NO and a molecular weight of 291.48 g/mol. Its IUPAC name is N-[2-[(2E,4E,6E)-5-ethenyl-8,8-dimethylnona-2,4,6-trien-3-yl]oxyethyl]-2-methylpropan-2-amine.
| Compound Name | N-[2-[(2E,4E,6E)-5-ethenyl-8,8-dimethylnona-2,4,6-trien-3-yl]oxyethyl]-2-methylpropan-2-amine |
|---|---|
| PubChem CID | 135174820 |
| Molecular Formula | C19H33NO |
| Molecular Weight | 291.48 g/mol |
| Exact Mass | 291.26 |
| IUPAC Name | N-[2-[(2E,4E,6E)-5-ethenyl-8,8-dimethylnona-2,4,6-trien-3-yl]oxyethyl]-2-methylpropan-2-amine |
| SMILES | C=CC(/C=C/C(C)(C)C)=C\C(=C/C)OCCNC(C)(C)C |
| InChI | InChI=1S/C19H33NO/c1-9-16(11-12-18(3,4)5)15-17(10-2)21-14-13-20-19(6,7)8/h9-12,15,20H,1,13-14H2,2-8H3/b12-11+,16-15+,17-10+ |
| InChIKey | UVRRKEGIDRGNLE-IUOGWBCOSA-N |
| XLogP | 5.01 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.48 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|