C11H17N — CID 135175151
2,3-bis(ethenyl)-N,N-dimethylpenta-2,4-dien-1-amine (PubChem CID 135175151) has the molecular formula C11H17N and a molecular weight of 163.26 g/mol. Its IUPAC name is 2,3-bis(ethenyl)-N,N-dimethylpenta-2,4-dien-1-amine.
| Compound Name | 2,3-bis(ethenyl)-N,N-dimethylpenta-2,4-dien-1-amine |
|---|---|
| PubChem CID | 135175151 |
| Molecular Formula | C11H17N |
| Molecular Weight | 163.26 g/mol |
| Exact Mass | 163.14 |
| IUPAC Name | 2,3-bis(ethenyl)-N,N-dimethylpenta-2,4-dien-1-amine |
| SMILES | C=CC(C=C)=C(C=C)CN(C)C |
| InChI | InChI=1S/C11H17N/c1-6-10(7-2)11(8-3)9-12(4)5/h6-8H,1-3,9H2,4-5H3 |
| InChIKey | NFCCLYIHWMPZSN-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 163.26 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|