C18H17F2IN2O — CID 135175387
3,3-difluoro-3-(4-iodophenyl)-2-[(2-methoxy-1-phenylethyl)amino]propanenitrile (PubChem CID 135175387) has the molecular formula C18H17F2IN2O and a molecular weight of 442.25 g/mol. Its IUPAC name is 3,3-difluoro-3-(4-iodophenyl)-2-[(2-methoxy-1-phenylethyl)amino]propanenitrile.
| Compound Name | 3,3-difluoro-3-(4-iodophenyl)-2-[(2-methoxy-1-phenylethyl)amino]propanenitrile |
|---|---|
| PubChem CID | 135175387 |
| Molecular Formula | C18H17F2IN2O |
| Molecular Weight | 442.25 g/mol |
| Exact Mass | 442.04 |
| IUPAC Name | 3,3-difluoro-3-(4-iodophenyl)-2-[(2-methoxy-1-phenylethyl)amino]propanenitrile |
| SMILES | COCC(NC(C#N)C(F)(F)c1ccc(I)cc1)c1ccccc1 |
| InChI | InChI=1S/C18H17F2IN2O/c1-24-12-16(13-5-3-2-4-6-13)23-17(11-22)18(19,20)14-7-9-15(21)10-8-14/h2-10,16-17,23H,12H2,1H3 |
| InChIKey | QYDVOPDXGVQBGG-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 45.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.25 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|