C10H22N2O — CID 135175911
N,N-diethyl-2-[methyl(propyl)amino]acetamide (PubChem CID 135175911) has the molecular formula C10H22N2O and a molecular weight of 186.30 g/mol. Its IUPAC name is N,N-diethyl-2-[methyl(propyl)amino]acetamide.
| Compound Name | N,N-diethyl-2-[methyl(propyl)amino]acetamide |
|---|---|
| PubChem CID | 135175911 |
| Molecular Formula | C10H22N2O |
| Molecular Weight | 186.30 g/mol |
| Exact Mass | 186.17 |
| IUPAC Name | N,N-diethyl-2-[methyl(propyl)amino]acetamide |
| SMILES | CCCN(C)CC(=O)N(CC)CC |
| InChI | InChI=1S/C10H22N2O/c1-5-8-11(4)9-10(13)12(6-2)7-3/h5-9H2,1-4H3 |
| InChIKey | LGQLISRXMXWKHR-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.30 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |