C27H27ClFN5O3 — CID 135176043
(2R)-16-chloro-13-fluoro-7-methyl-19-(4-prop-2-enoylpiperazin-1-yl)-8-oxa-1,20,23-triazapentacyclo[13.6.2.02,7.09,14.018,22]tricosa-9(14),10,12,15,17,19,22-heptaen-21-one (PubChem CID 135176043) has the molecular formula C27H27ClFN5O3 and a molecular weight of 524.00 g/mol. Its IUPAC name is (2R)-16-chloro-13-fluoro-7-methyl-19-(4-prop-2-enoylpiperazin-1-yl)-8-oxa-1,20,23-triazapentacyclo[13.6.2.02,7.09,14.018,22]tricosa-9(14),10,12,15,17,19,22-heptaen-21-one.
| Compound Name | (2R)-16-chloro-13-fluoro-7-methyl-19-(4-prop-2-enoylpiperazin-1-yl)-8-oxa-1,20,23-triazapentacyclo[13.6.2.02,7.09,14.018,22]tricosa-9(14),10,12,15,17,19,22-heptaen-21-one |
|---|---|
| PubChem CID | 135176043 |
| Molecular Formula | C27H27ClFN5O3 |
| Molecular Weight | 524.00 g/mol |
| Exact Mass | 523.18 |
| IUPAC Name | (2R)-16-chloro-13-fluoro-7-methyl-19-(4-prop-2-enoylpiperazin-1-yl)-8-oxa-1,20,23-triazapentacyclo[13.6.2.02,7.09,14.018,22]tricosa-9(14),10,12,15,17,19,22-heptaen-21-one |
| SMILES | C=CC(=O)N1CCN(c2nc(=O)n3c4nc(c(Cl)cc24)-c2c(F)cccc2OC2(C)CCCC[C@@H]32)CC1 |
| InChI | InChI=1S/C27H27ClFN5O3/c1-3-21(35)32-11-13-33(14-12-32)24-16-15-17(28)23-22-18(29)7-6-8-19(22)37-27(2)10-5-4-9-20(27)34(25(16)30-23)26(36)31-24/h3,6-8,15,20H,1,4-5,9-14H2,2H3/t20-,27?/m1/s1 |
| InChIKey | GPJIKTXMDDRTRU-ACVCQEAVSA-N |
| XLogP | 4.35 |
| TPSA | 80.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.00 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|