C32H31ClN4O2 — CID 135176168
2-[3-[3-[7-chloro-5-(pyrrolidin-1-ylmethyl)-1,3-benzoxazol-2-yl]-2-methylphenyl]-2-methylphenyl]-4,5,6,7-tetrahydro-[1,3]oxazolo[5,4-c]pyridine (PubChem CID 135176168) has the molecular formula C32H31ClN4O2 and a molecular weight of 539.08 g/mol. Its IUPAC name is 2-[3-[3-[7-chloro-5-(pyrrolidin-1-ylmethyl)-1,3-benzoxazol-2-yl]-2-methylphenyl]-2-methylphenyl]-4,5,6,7-tetrahydro-[1,3]oxazolo[5,4-c]pyridine.
| Compound Name | 2-[3-[3-[7-chloro-5-(pyrrolidin-1-ylmethyl)-1,3-benzoxazol-2-yl]-2-methylphenyl]-2-methylphenyl]-4,5,6,7-tetrahydro-[1,3]oxazolo[5,4-c]pyridine |
|---|---|
| PubChem CID | 135176168 |
| Molecular Formula | C32H31ClN4O2 |
| Molecular Weight | 539.08 g/mol |
| Exact Mass | 538.21 |
| IUPAC Name | 2-[3-[3-[7-chloro-5-(pyrrolidin-1-ylmethyl)-1,3-benzoxazol-2-yl]-2-methylphenyl]-2-methylphenyl]-4,5,6,7-tetrahydro-[1,3]oxazolo[5,4-c]pyridine |
| SMILES | Cc1c(-c2nc3c(o2)CNCC3)cccc1-c1cccc(-c2nc3cc(CN4CCCC4)cc(Cl)c3o2)c1C |
| InChI | InChI=1S/C32H31ClN4O2/c1-19-22(7-5-9-24(19)31-35-27-11-12-34-17-29(27)38-31)23-8-6-10-25(20(23)2)32-36-28-16-21(15-26(33)30(28)39-32)18-37-13-3-4-14-37/h5-10,15-16,34H,3-4,11-14,17-18H2,1-2H3 |
| InChIKey | WBUZAZQOQAHDPZ-UHFFFAOYSA-N |
| XLogP | 7.33 |
| TPSA | 67.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.08 |
| LogP ≤ 5 | 7.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |