C20H29N3O5 — CID 135177057
ethyl (E)-3-[6-[2-methylpropyl(oxan-4-yl)amino]-5-nitro-3-pyridinyl]but-2-enoate (PubChem CID 135177057) has the molecular formula C20H29N3O5 and a molecular weight of 391.47 g/mol. Its IUPAC name is ethyl (E)-3-[6-[2-methylpropyl(oxan-4-yl)amino]-5-nitro-3-pyridinyl]but-2-enoate.
| Compound Name | ethyl (E)-3-[6-[2-methylpropyl(oxan-4-yl)amino]-5-nitro-3-pyridinyl]but-2-enoate |
|---|---|
| PubChem CID | 135177057 |
| Molecular Formula | C20H29N3O5 |
| Molecular Weight | 391.47 g/mol |
| Exact Mass | 391.21 |
| IUPAC Name | ethyl (E)-3-[6-[2-methylpropyl(oxan-4-yl)amino]-5-nitro-3-pyridinyl]but-2-enoate |
| SMILES | CCOC(=O)/C=C(\C)c1cnc(N(CC(C)C)C2CCOCC2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C20H29N3O5/c1-5-28-19(24)10-15(4)16-11-18(23(25)26)20(21-12-16)22(13-14(2)3)17-6-8-27-9-7-17/h10-12,14,17H,5-9,13H2,1-4H3/b15-10+ |
| InChIKey | CYHVTWVMBQKVOD-XNTDXEJSSA-N |
| XLogP | 3.60 |
| TPSA | 94.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.47 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|