C21H30IN3 — CID 135177735
2-[(2Z,4Z)-hexa-2,4-dienyl]-4-iodo-6-[(1E,3Z,5Z,7Z)-3-prop-2-enylidenenona-1,5,7-trienyl]-1,3,5-triazinane (PubChem CID 135177735) has the molecular formula C21H30IN3 and a molecular weight of 451.40 g/mol. Its IUPAC name is 2-[(2Z,4Z)-hexa-2,4-dienyl]-4-iodo-6-[(1E,3Z,5Z,7Z)-3-prop-2-enylidenenona-1,5,7-trienyl]-1,3,5-triazinane.
| Compound Name | 2-[(2Z,4Z)-hexa-2,4-dienyl]-4-iodo-6-[(1E,3Z,5Z,7Z)-3-prop-2-enylidenenona-1,5,7-trienyl]-1,3,5-triazinane |
|---|---|
| PubChem CID | 135177735 |
| Molecular Formula | C21H30IN3 |
| Molecular Weight | 451.40 g/mol |
| Exact Mass | 451.15 |
| IUPAC Name | 2-[(2Z,4Z)-hexa-2,4-dienyl]-4-iodo-6-[(1E,3Z,5Z,7Z)-3-prop-2-enylidenenona-1,5,7-trienyl]-1,3,5-triazinane |
| SMILES | C=C/C=C(\C=C\C1NC(I)NC(C/C=C\C=C/C)N1)C/C=C\C=C/C |
| InChI | InChI=1S/C21H30IN3/c1-4-7-9-11-14-18(13-6-3)16-17-20-23-19(24-21(22)25-20)15-12-10-8-5-2/h4-13,16-17,19-21,23-25H,3,14-15H2,1-2H3/b7-4-,8-5-,11-9-,12-10-,17-16+,18-13- |
| InChIKey | BJLXHJHOCARTPW-QTWYBUCZSA-N |
| XLogP | 4.85 |
| TPSA | 36.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.40 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|