About 6-([1]benzothiolo[7,6-g][1]benzofuran-7-yl)-2-methyl-1H-imidazo[4,5-b]pyridine
6-([1]benzothiolo[7,6-g][1]benzofuran-7-yl)-2-methyl-1H-imidazo[4,5-b]pyridine (PubChem CID 135177873) has the molecular formula C21H13N3OS
and a molecular weight of 355.42 g/mol. Its IUPAC name is 6-([1]benzothiolo[7,6-g][1]benzofuran-7-yl)-2-methyl-1H-imidazo[4,5-b]pyridine.
Molecular Properties
| Compound Name | 6-([1]benzothiolo[7,6-g][1]benzofuran-7-yl)-2-methyl-1H-imidazo[4,5-b]pyridine |
| PubChem CID | 135177873 |
| Molecular Formula | C21H13N3OS |
| Molecular Weight | 355.42 g/mol |
| Exact Mass | 355.08 |
| IUPAC Name | 6-([1]benzothiolo[7,6-g][1]benzofuran-7-yl)-2-methyl-1H-imidazo[4,5-b]pyridine |
| SMILES | Cc1nc2ncc(-c3cc4ccc5c(ccc6ccoc65)c4s3)cc2[nH]1 |
| InChI | InChI=1S/C21H13N3OS/c1-11-23-17-8-14(10-22-21(17)24-11)18-9-13-3-4-15-16(20(13)26-18)5-2-12-6-7-25-19(12)15/h2-10H,1H3,(H,22,23,24) |
| InChIKey | ORERLEQXVRJYFB-UHFFFAOYSA-N |
| XLogP | 6.05 |
| TPSA | 54.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 355.42 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 6-([1]benzothiolo[7,6-g][1]benzofuran-7-yl)-2-methyl-1H-imidazo[4,5-b]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-([1]benzothiolo[7,6-g][1]benzofuran-7-yl)-2-methyl-1H-imidazo[4,5-b]pyridine?
The IUPAC name of 6-([1]benzothiolo[7,6-g][1]benzofuran-7-yl)-2-methyl-1H-imidazo[4,5-b]pyridine (CID 135177873) is 6-([1]benzothiolo[7,6-g][1]benzofuran-7-yl)-2-methyl-1H-imidazo[4,5-b]pyridine.
What is the SMILES notation for 6-([1]benzothiolo[7,6-g][1]benzofuran-7-yl)-2-methyl-1H-imidazo[4,5-b]pyridine?
The canonical SMILES for 6-([1]benzothiolo[7,6-g][1]benzofuran-7-yl)-2-methyl-1H-imidazo[4,5-b]pyridine is Cc1nc2ncc(-c3cc4ccc5c(ccc6ccoc65)c4s3)cc2[nH]1.
What is the InChIKey of 6-([1]benzothiolo[7,6-g][1]benzofuran-7-yl)-2-methyl-1H-imidazo[4,5-b]pyridine?
The InChIKey is ORERLEQXVRJYFB-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H13N3OS/c1-11-23-17-8-14(10-22-21(17)24-11)18-9-13-3-4-15-16(20(13)26-18)5-2-12-6-7-25-19(12)15/h2-10H,1H3,(H,22,23,24).
What are the key properties of 6-([1]benzothiolo[7,6-g][1]benzofuran-7-yl)-2-methyl-1H-imidazo[4,5-b]pyridine?
6-([1]benzothiolo[7,6-g][1]benzofuran-7-yl)-2-methyl-1H-imidazo[4,5-b]pyridine has a molecular weight of 355.42 g/mol, XLogP of 6.05, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-([1]benzothiolo[7,6-g][1]benzofuran-7-yl)-2-methyl-1H-imidazo[4,5-b]pyridine is sourced from PubChem (CID 135177873), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).