About N-[(6-oxo-4,5-dihydrothieno[3,4-c]pyrrol-3-yl)methyl]propanethioamide
N-[(6-oxo-4,5-dihydrothieno[3,4-c]pyrrol-3-yl)methyl]propanethioamide (PubChem CID 135178830) has the molecular formula C10H12N2OS2
and a molecular weight of 240.35 g/mol. Its IUPAC name is N-[(6-oxo-4,5-dihydrothieno[3,4-c]pyrrol-3-yl)methyl]propanethioamide.
Molecular Properties
| Compound Name | N-[(6-oxo-4,5-dihydrothieno[3,4-c]pyrrol-3-yl)methyl]propanethioamide |
| PubChem CID | 135178830 |
| Molecular Formula | C10H12N2OS2 |
| Molecular Weight | 240.35 g/mol |
| Exact Mass | 240.04 |
| IUPAC Name | N-[(6-oxo-4,5-dihydrothieno[3,4-c]pyrrol-3-yl)methyl]propanethioamide |
| SMILES | CCC(=S)NCc1scc2c1CNC2=O |
| InChI | InChI=1S/C10H12N2OS2/c1-2-9(14)11-4-8-6-3-12-10(13)7(6)5-15-8/h5H,2-4H2,1H3,(H,11,14)(H,12,13) |
| InChIKey | KHZSSEZXPZPYOO-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 240.35 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze N-[(6-oxo-4,5-dihydrothieno[3,4-c]pyrrol-3-yl)methyl]propanethioamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(6-oxo-4,5-dihydrothieno[3,4-c]pyrrol-3-yl)methyl]propanethioamide?
The IUPAC name of N-[(6-oxo-4,5-dihydrothieno[3,4-c]pyrrol-3-yl)methyl]propanethioamide (CID 135178830) is N-[(6-oxo-4,5-dihydrothieno[3,4-c]pyrrol-3-yl)methyl]propanethioamide.
What is the SMILES notation for N-[(6-oxo-4,5-dihydrothieno[3,4-c]pyrrol-3-yl)methyl]propanethioamide?
The canonical SMILES for N-[(6-oxo-4,5-dihydrothieno[3,4-c]pyrrol-3-yl)methyl]propanethioamide is CCC(=S)NCc1scc2c1CNC2=O.
What is the InChIKey of N-[(6-oxo-4,5-dihydrothieno[3,4-c]pyrrol-3-yl)methyl]propanethioamide?
The InChIKey is KHZSSEZXPZPYOO-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12N2OS2/c1-2-9(14)11-4-8-6-3-12-10(13)7(6)5-15-8/h5H,2-4H2,1H3,(H,11,14)(H,12,13).
What are the key properties of N-[(6-oxo-4,5-dihydrothieno[3,4-c]pyrrol-3-yl)methyl]propanethioamide?
N-[(6-oxo-4,5-dihydrothieno[3,4-c]pyrrol-3-yl)methyl]propanethioamide has a molecular weight of 240.35 g/mol, XLogP of 1.82, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(6-oxo-4,5-dihydrothieno[3,4-c]pyrrol-3-yl)methyl]propanethioamide is sourced from PubChem (CID 135178830), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).