C29H27Cl2N5O4 — CID 135179743
N-[2-[[7-(2,6-dichloro-3,5-dimethoxyphenyl)-2,6-naphthyridin-3-yl]amino]-5-morpholin-4-ylphenyl]prop-2-enamide (PubChem CID 135179743) has the molecular formula C29H27Cl2N5O4 and a molecular weight of 580.47 g/mol. Its IUPAC name is N-[2-[[7-(2,6-dichloro-3,5-dimethoxyphenyl)-2,6-naphthyridin-3-yl]amino]-5-morpholin-4-ylphenyl]prop-2-enamide.
| Compound Name | N-[2-[[7-(2,6-dichloro-3,5-dimethoxyphenyl)-2,6-naphthyridin-3-yl]amino]-5-morpholin-4-ylphenyl]prop-2-enamide |
|---|---|
| PubChem CID | 135179743 |
| Molecular Formula | C29H27Cl2N5O4 |
| Molecular Weight | 580.47 g/mol |
| Exact Mass | 579.14 |
| IUPAC Name | N-[2-[[7-(2,6-dichloro-3,5-dimethoxyphenyl)-2,6-naphthyridin-3-yl]amino]-5-morpholin-4-ylphenyl]prop-2-enamide |
| SMILES | C=CC(=O)Nc1cc(N2CCOCC2)ccc1Nc1cc2cnc(-c3c(Cl)c(OC)cc(OC)c3Cl)cc2cn1 |
| InChI | InChI=1S/C29H27Cl2N5O4/c1-4-26(37)35-21-13-19(36-7-9-40-10-8-36)5-6-20(21)34-25-12-18-15-32-22(11-17(18)16-33-25)27-28(30)23(38-2)14-24(39-3)29(27)31/h4-6,11-16H,1,7-10H2,2-3H3,(H,33,34)(H,35,37) |
| InChIKey | LPDHUONDWKJKLE-UHFFFAOYSA-N |
| XLogP | 6.33 |
| TPSA | 97.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.47 |
| LogP ≤ 5 | 6.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|