C26H26Cl2F3N5O4 — CID 135179861
N-[(3S,4S)-3-[[7-(2,6-dichloro-3,5-dimethoxyphenyl)-5-(2,2,2-trifluoroethylamino)-2,6-naphthyridin-3-yl]amino]oxan-4-yl]prop-2-enamide (PubChem CID 135179861) has the molecular formula C26H26Cl2F3N5O4 and a molecular weight of 600.43 g/mol. Its IUPAC name is N-[(3S,4S)-3-[[7-(2,6-dichloro-3,5-dimethoxyphenyl)-5-(2,2,2-trifluoroethylamino)-2,6-naphthyridin-3-yl]amino]oxan-4-yl]prop-2-enamide.
| Compound Name | N-[(3S,4S)-3-[[7-(2,6-dichloro-3,5-dimethoxyphenyl)-5-(2,2,2-trifluoroethylamino)-2,6-naphthyridin-3-yl]amino]oxan-4-yl]prop-2-enamide |
|---|---|
| PubChem CID | 135179861 |
| Molecular Formula | C26H26Cl2F3N5O4 |
| Molecular Weight | 600.43 g/mol |
| Exact Mass | 599.13 |
| IUPAC Name | N-[(3S,4S)-3-[[7-(2,6-dichloro-3,5-dimethoxyphenyl)-5-(2,2,2-trifluoroethylamino)-2,6-naphthyridin-3-yl]amino]oxan-4-yl]prop-2-enamide |
| SMILES | C=CC(=O)N[C@H]1CCOC[C@H]1Nc1cc2c(NCC(F)(F)F)nc(-c3c(Cl)c(OC)cc(OC)c3Cl)cc2cn1 |
| InChI | InChI=1S/C26H26Cl2F3N5O4/c1-4-21(37)35-15-5-6-40-11-17(15)34-20-8-14-13(10-32-20)7-16(36-25(14)33-12-26(29,30)31)22-23(27)18(38-2)9-19(39-3)24(22)28/h4,7-10,15,17H,1,5-6,11-12H2,2-3H3,(H,32,34)(H,33,36)(H,35,37)/t15-,17+/m0/s1 |
| InChIKey | LFEJFGIYTFRRPZ-DOTOQJQBSA-N |
| XLogP | 5.47 |
| TPSA | 106.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 600.43 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|