C25H25Cl2F3N6O4 — CID 135179894
N-[(3S,4S)-3-[[6-(2,6-dichloro-3,5-dimethoxyphenyl)-8-(2,2,2-trifluoroethylamino)pyrido[3,4-d]pyrimidin-2-yl]amino]oxan-4-yl]prop-2-enamide (PubChem CID 135179894) has the molecular formula C25H25Cl2F3N6O4 and a molecular weight of 601.41 g/mol. Its IUPAC name is N-[(3S,4S)-3-[[6-(2,6-dichloro-3,5-dimethoxyphenyl)-8-(2,2,2-trifluoroethylamino)pyrido[3,4-d]pyrimidin-2-yl]amino]oxan-4-yl]prop-2-enamide.
| Compound Name | N-[(3S,4S)-3-[[6-(2,6-dichloro-3,5-dimethoxyphenyl)-8-(2,2,2-trifluoroethylamino)pyrido[3,4-d]pyrimidin-2-yl]amino]oxan-4-yl]prop-2-enamide |
|---|---|
| PubChem CID | 135179894 |
| Molecular Formula | C25H25Cl2F3N6O4 |
| Molecular Weight | 601.41 g/mol |
| Exact Mass | 600.13 |
| IUPAC Name | N-[(3S,4S)-3-[[6-(2,6-dichloro-3,5-dimethoxyphenyl)-8-(2,2,2-trifluoroethylamino)pyrido[3,4-d]pyrimidin-2-yl]amino]oxan-4-yl]prop-2-enamide |
| SMILES | C=CC(=O)N[C@H]1CCOC[C@H]1Nc1ncc2cc(-c3c(Cl)c(OC)cc(OC)c3Cl)nc(NCC(F)(F)F)c2n1 |
| InChI | InChI=1S/C25H25Cl2F3N6O4/c1-4-18(37)33-13-5-6-40-10-15(13)35-24-31-9-12-7-14(34-23(22(12)36-24)32-11-25(28,29)30)19-20(26)16(38-2)8-17(39-3)21(19)27/h4,7-9,13,15H,1,5-6,10-11H2,2-3H3,(H,32,34)(H,33,37)(H,31,35,36)/t13-,15+/m0/s1 |
| InChIKey | MUEOUCJVQCKABW-DZGCQCFKSA-N |
| XLogP | 4.86 |
| TPSA | 119.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 601.41 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|