C23H20Cl2N6O3 — CID 135180240
N-[3-[[7-(2,6-dichloro-3,5-dimethoxyphenyl)-2,6-naphthyridin-3-yl]amino]-1-methylpyrazol-4-yl]prop-2-enamide (PubChem CID 135180240) has the molecular formula C23H20Cl2N6O3 and a molecular weight of 499.36 g/mol. Its IUPAC name is N-[3-[[7-(2,6-dichloro-3,5-dimethoxyphenyl)-2,6-naphthyridin-3-yl]amino]-1-methylpyrazol-4-yl]prop-2-enamide.
| Compound Name | N-[3-[[7-(2,6-dichloro-3,5-dimethoxyphenyl)-2,6-naphthyridin-3-yl]amino]-1-methylpyrazol-4-yl]prop-2-enamide |
|---|---|
| PubChem CID | 135180240 |
| Molecular Formula | C23H20Cl2N6O3 |
| Molecular Weight | 499.36 g/mol |
| Exact Mass | 498.10 |
| IUPAC Name | N-[3-[[7-(2,6-dichloro-3,5-dimethoxyphenyl)-2,6-naphthyridin-3-yl]amino]-1-methylpyrazol-4-yl]prop-2-enamide |
| SMILES | C=CC(=O)Nc1cn(C)nc1Nc1cc2cnc(-c3c(Cl)c(OC)cc(OC)c3Cl)cc2cn1 |
| InChI | InChI=1S/C23H20Cl2N6O3/c1-5-19(32)28-15-11-31(2)30-23(15)29-18-7-13-9-26-14(6-12(13)10-27-18)20-21(24)16(33-3)8-17(34-4)22(20)25/h5-11H,1H2,2-4H3,(H,28,32)(H,27,29,30) |
| InChIKey | WFTNLDMOJUFUOV-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 103.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.36 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|