C27H28Cl2F2N6O4 — CID 135180336
N-[(3R,4S)-4-[[2-(2,6-dichloro-3,5-dimethoxyphenyl)-4-[(3,3-difluorocyclopentyl)amino]pyrido[3,4-d]pyrimidin-6-yl]amino]oxolan-3-yl]prop-2-enamide (PubChem CID 135180336) has the molecular formula C27H28Cl2F2N6O4 and a molecular weight of 609.46 g/mol. Its IUPAC name is N-[(3R,4S)-4-[[2-(2,6-dichloro-3,5-dimethoxyphenyl)-4-[(3,3-difluorocyclopentyl)amino]pyrido[3,4-d]pyrimidin-6-yl]amino]oxolan-3-yl]prop-2-enamide.
| Compound Name | N-[(3R,4S)-4-[[2-(2,6-dichloro-3,5-dimethoxyphenyl)-4-[(3,3-difluorocyclopentyl)amino]pyrido[3,4-d]pyrimidin-6-yl]amino]oxolan-3-yl]prop-2-enamide |
|---|---|
| PubChem CID | 135180336 |
| Molecular Formula | C27H28Cl2F2N6O4 |
| Molecular Weight | 609.46 g/mol |
| Exact Mass | 608.15 |
| IUPAC Name | N-[(3R,4S)-4-[[2-(2,6-dichloro-3,5-dimethoxyphenyl)-4-[(3,3-difluorocyclopentyl)amino]pyrido[3,4-d]pyrimidin-6-yl]amino]oxolan-3-yl]prop-2-enamide |
| SMILES | C=CC(=O)N[C@H]1COC[C@H]1Nc1cc2c(NC3CCC(F)(F)C3)nc(-c3c(Cl)c(OC)cc(OC)c3Cl)nc2cn1 |
| InChI | InChI=1S/C27H28Cl2F2N6O4/c1-4-21(38)35-17-12-41-11-16(17)34-20-7-14-15(10-32-20)36-26(37-25(14)33-13-5-6-27(30,31)9-13)22-23(28)18(39-2)8-19(40-3)24(22)29/h4,7-8,10,13,16-17H,1,5-6,9,11-12H2,2-3H3,(H,32,34)(H,35,38)(H,33,36,37)/t13?,16-,17+/m1/s1 |
| InChIKey | JGQVDVPJZIQKPH-IIZJFRANSA-N |
| XLogP | 5.10 |
| TPSA | 119.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 609.46 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|