C27H27Cl2F2N5O4 — CID 135180464
N-[(3R,4S)-4-[[7-(2,6-dichloro-3,5-dimethoxyphenyl)-5-(3,3-difluoropyrrolidin-1-yl)-2,6-naphthyridin-3-yl]amino]oxolan-3-yl]prop-2-enamide (PubChem CID 135180464) has the molecular formula C27H27Cl2F2N5O4 and a molecular weight of 594.45 g/mol. Its IUPAC name is N-[(3R,4S)-4-[[7-(2,6-dichloro-3,5-dimethoxyphenyl)-5-(3,3-difluoropyrrolidin-1-yl)-2,6-naphthyridin-3-yl]amino]oxolan-3-yl]prop-2-enamide.
| Compound Name | N-[(3R,4S)-4-[[7-(2,6-dichloro-3,5-dimethoxyphenyl)-5-(3,3-difluoropyrrolidin-1-yl)-2,6-naphthyridin-3-yl]amino]oxolan-3-yl]prop-2-enamide |
|---|---|
| PubChem CID | 135180464 |
| Molecular Formula | C27H27Cl2F2N5O4 |
| Molecular Weight | 594.45 g/mol |
| Exact Mass | 593.14 |
| IUPAC Name | N-[(3R,4S)-4-[[7-(2,6-dichloro-3,5-dimethoxyphenyl)-5-(3,3-difluoropyrrolidin-1-yl)-2,6-naphthyridin-3-yl]amino]oxolan-3-yl]prop-2-enamide |
| SMILES | C=CC(=O)N[C@H]1COC[C@H]1Nc1cc2c(N3CCC(F)(F)C3)nc(-c3c(Cl)c(OC)cc(OC)c3Cl)cc2cn1 |
| InChI | InChI=1S/C27H27Cl2F2N5O4/c1-4-22(37)34-18-12-40-11-17(18)33-21-8-15-14(10-32-21)7-16(35-26(15)36-6-5-27(30,31)13-36)23-24(28)19(38-2)9-20(39-3)25(23)29/h4,7-10,17-18H,1,5-6,11-13H2,2-3H3,(H,32,33)(H,34,37)/t17-,18+/m1/s1 |
| InChIKey | DYOOKSZVDKAJGI-MSOLQXFVSA-N |
| XLogP | 4.95 |
| TPSA | 97.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.45 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|