C20H18F4N4O — CID 135180521
N-(7-fluoro-1,2,3,4,5,6-hexahydroisoquinolin-6-yl)-1-[(3,4,5-trifluorophenyl)methyl]imidazole-4-carboxamide (PubChem CID 135180521) has the molecular formula C20H18F4N4O and a molecular weight of 406.38 g/mol. Its IUPAC name is N-(7-fluoro-1,2,3,4,5,6-hexahydroisoquinolin-6-yl)-1-[(3,4,5-trifluorophenyl)methyl]imidazole-4-carboxamide.
| Compound Name | N-(7-fluoro-1,2,3,4,5,6-hexahydroisoquinolin-6-yl)-1-[(3,4,5-trifluorophenyl)methyl]imidazole-4-carboxamide |
|---|---|
| PubChem CID | 135180521 |
| Molecular Formula | C20H18F4N4O |
| Molecular Weight | 406.38 g/mol |
| Exact Mass | 406.14 |
| IUPAC Name | N-(7-fluoro-1,2,3,4,5,6-hexahydroisoquinolin-6-yl)-1-[(3,4,5-trifluorophenyl)methyl]imidazole-4-carboxamide |
| SMILES | O=C(NC1CC2=C(C=C1F)CNCC2)c1cn(Cc2cc(F)c(F)c(F)c2)cn1 |
| InChI | InChI=1S/C20H18F4N4O/c21-14-5-13-7-25-2-1-12(13)6-17(14)27-20(29)18-9-28(10-26-18)8-11-3-15(22)19(24)16(23)4-11/h3-5,9-10,17,25H,1-2,6-8H2,(H,27,29) |
| InChIKey | SONLODHILQZAKA-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 58.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.38 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|