C18H15Cl2F3N4O2 — CID 135181096
3-(2,6-dichloro-3,5-dimethoxyphenyl)-1-N-(2,2,2-trifluoroethyl)-2,6-naphthyridine-1,7-diamine (PubChem CID 135181096) has the molecular formula C18H15Cl2F3N4O2 and a molecular weight of 447.24 g/mol. Its IUPAC name is 3-(2,6-dichloro-3,5-dimethoxyphenyl)-1-N-(2,2,2-trifluoroethyl)-2,6-naphthyridine-1,7-diamine.
| Compound Name | 3-(2,6-dichloro-3,5-dimethoxyphenyl)-1-N-(2,2,2-trifluoroethyl)-2,6-naphthyridine-1,7-diamine |
|---|---|
| PubChem CID | 135181096 |
| Molecular Formula | C18H15Cl2F3N4O2 |
| Molecular Weight | 447.24 g/mol |
| Exact Mass | 446.05 |
| IUPAC Name | 3-(2,6-dichloro-3,5-dimethoxyphenyl)-1-N-(2,2,2-trifluoroethyl)-2,6-naphthyridine-1,7-diamine |
| SMILES | COc1cc(OC)c(Cl)c(-c2cc3cnc(N)cc3c(NCC(F)(F)F)n2)c1Cl |
| InChI | InChI=1S/C18H15Cl2F3N4O2/c1-28-11-5-12(29-2)16(20)14(15(11)19)10-3-8-6-25-13(24)4-9(8)17(27-10)26-7-18(21,22)23/h3-6H,7H2,1-2H3,(H2,24,25)(H,26,27) |
| InChIKey | AZBJZEKTEAWGII-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 82.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.24 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |