C13H19N — CID 135181117
(3Z,5Z)-3-methyl-N-[(1E)-2-methylbuta-1,3-dienyl]hepta-3,5-dien-2-imine (PubChem CID 135181117) has the molecular formula C13H19N and a molecular weight of 189.30 g/mol. Its IUPAC name is (3Z,5Z)-3-methyl-N-[(1E)-2-methylbuta-1,3-dienyl]hepta-3,5-dien-2-imine.
| Compound Name | (3Z,5Z)-3-methyl-N-[(1E)-2-methylbuta-1,3-dienyl]hepta-3,5-dien-2-imine |
|---|---|
| PubChem CID | 135181117 |
| Molecular Formula | C13H19N |
| Molecular Weight | 189.30 g/mol |
| Exact Mass | 189.15 |
| IUPAC Name | (3Z,5Z)-3-methyl-N-[(1E)-2-methylbuta-1,3-dienyl]hepta-3,5-dien-2-imine |
| SMILES | C=C/C(C)=C/N=C(C)/C(C)=C\C=C/C |
| InChI | InChI=1S/C13H19N/c1-6-8-9-12(4)13(5)14-10-11(3)7-2/h6-10H,2H2,1,3-5H3/b8-6-,11-10+,12-9-,14-13+ |
| InChIKey | QIYDLVSOWREASE-KPQZQRNVSA-N |
| XLogP | 4.06 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.30 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|