About 2,4-dichloro-6-(3,5-dimethoxyphenyl)pyrido[3,4-d]pyrimidine
2,4-dichloro-6-(3,5-dimethoxyphenyl)pyrido[3,4-d]pyrimidine (PubChem CID 135181348) has the molecular formula C15H11Cl2N3O2
and a molecular weight of 336.18 g/mol. Its IUPAC name is 2,4-dichloro-6-(3,5-dimethoxyphenyl)pyrido[3,4-d]pyrimidine.
Molecular Properties
| Compound Name | 2,4-dichloro-6-(3,5-dimethoxyphenyl)pyrido[3,4-d]pyrimidine |
| PubChem CID | 135181348 |
| Molecular Formula | C15H11Cl2N3O2 |
| Molecular Weight | 336.18 g/mol |
| Exact Mass | 335.02 |
| IUPAC Name | 2,4-dichloro-6-(3,5-dimethoxyphenyl)pyrido[3,4-d]pyrimidine |
| SMILES | COc1cc(OC)cc(-c2cc3c(Cl)nc(Cl)nc3cn2)c1 |
| InChI | InChI=1S/C15H11Cl2N3O2/c1-21-9-3-8(4-10(5-9)22-2)12-6-11-13(7-18-12)19-15(17)20-14(11)16/h3-7H,1-2H3 |
| InChIKey | KQUBPQCOGIDGAO-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 57.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 336.18 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2,4-dichloro-6-(3,5-dimethoxyphenyl)pyrido[3,4-d]pyrimidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,4-dichloro-6-(3,5-dimethoxyphenyl)pyrido[3,4-d]pyrimidine?
The IUPAC name of 2,4-dichloro-6-(3,5-dimethoxyphenyl)pyrido[3,4-d]pyrimidine (CID 135181348) is 2,4-dichloro-6-(3,5-dimethoxyphenyl)pyrido[3,4-d]pyrimidine.
What is the SMILES notation for 2,4-dichloro-6-(3,5-dimethoxyphenyl)pyrido[3,4-d]pyrimidine?
The canonical SMILES for 2,4-dichloro-6-(3,5-dimethoxyphenyl)pyrido[3,4-d]pyrimidine is COc1cc(OC)cc(-c2cc3c(Cl)nc(Cl)nc3cn2)c1.
What is the InChIKey of 2,4-dichloro-6-(3,5-dimethoxyphenyl)pyrido[3,4-d]pyrimidine?
The InChIKey is KQUBPQCOGIDGAO-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H11Cl2N3O2/c1-21-9-3-8(4-10(5-9)22-2)12-6-11-13(7-18-12)19-15(17)20-14(11)16/h3-7H,1-2H3.
What are the key properties of 2,4-dichloro-6-(3,5-dimethoxyphenyl)pyrido[3,4-d]pyrimidine?
2,4-dichloro-6-(3,5-dimethoxyphenyl)pyrido[3,4-d]pyrimidine has a molecular weight of 336.18 g/mol, XLogP of 4.02, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2,4-dichloro-6-(3,5-dimethoxyphenyl)pyrido[3,4-d]pyrimidine is sourced from PubChem (CID 135181348), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).