C21H19Cl2F2N3O2 — CID 135181371
7-chloro-3-(2-chloro-3,5-dimethoxy-6-methylphenyl)-1-(3,3-difluoropyrrolidin-1-yl)-2,6-naphthyridine (PubChem CID 135181371) has the molecular formula C21H19Cl2F2N3O2 and a molecular weight of 454.30 g/mol. Its IUPAC name is 7-chloro-3-(2-chloro-3,5-dimethoxy-6-methylphenyl)-1-(3,3-difluoropyrrolidin-1-yl)-2,6-naphthyridine.
| Compound Name | 7-chloro-3-(2-chloro-3,5-dimethoxy-6-methylphenyl)-1-(3,3-difluoropyrrolidin-1-yl)-2,6-naphthyridine |
|---|---|
| PubChem CID | 135181371 |
| Molecular Formula | C21H19Cl2F2N3O2 |
| Molecular Weight | 454.30 g/mol |
| Exact Mass | 453.08 |
| IUPAC Name | 7-chloro-3-(2-chloro-3,5-dimethoxy-6-methylphenyl)-1-(3,3-difluoropyrrolidin-1-yl)-2,6-naphthyridine |
| SMILES | COc1cc(OC)c(Cl)c(-c2cc3cnc(Cl)cc3c(N3CCC(F)(F)C3)n2)c1C |
| InChI | InChI=1S/C21H19Cl2F2N3O2/c1-11-15(29-2)8-16(30-3)19(23)18(11)14-6-12-9-26-17(22)7-13(12)20(27-14)28-5-4-21(24,25)10-28/h6-9H,4-5,10H2,1-3H3 |
| InChIKey | DHMNKOANFUNXGG-UHFFFAOYSA-N |
| XLogP | 5.77 |
| TPSA | 47.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.30 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|