C12H23NO — CID 135181456
(3Z)-N-(1-methoxyethyl)-N,2,2-trimethylhexa-3,5-dien-3-amine (PubChem CID 135181456) has the molecular formula C12H23NO and a molecular weight of 197.32 g/mol. Its IUPAC name is (3Z)-N-(1-methoxyethyl)-N,2,2-trimethylhexa-3,5-dien-3-amine.
| Compound Name | (3Z)-N-(1-methoxyethyl)-N,2,2-trimethylhexa-3,5-dien-3-amine |
|---|---|
| PubChem CID | 135181456 |
| Molecular Formula | C12H23NO |
| Molecular Weight | 197.32 g/mol |
| Exact Mass | 197.18 |
| IUPAC Name | (3Z)-N-(1-methoxyethyl)-N,2,2-trimethylhexa-3,5-dien-3-amine |
| SMILES | C=C/C=C(\N(C)C(C)OC)C(C)(C)C |
| InChI | InChI=1S/C12H23NO/c1-8-9-11(12(3,4)5)13(6)10(2)14-7/h8-10H,1H2,2-7H3/b11-9- |
| InChIKey | OWWFTYXXYPVXPF-LUAWRHEFSA-N |
| XLogP | 3.03 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.32 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|