C15H13N5OS — CID 135181704
8-(2-cyclopropylpyrimidin-4-yl)-6-oxo-3,4-dihydro-2H-pyrimido[2,1-b][1,3]thiazine-7-carbonitrile (PubChem CID 135181704) has the molecular formula C15H13N5OS and a molecular weight of 311.37 g/mol. Its IUPAC name is 8-(2-cyclopropylpyrimidin-4-yl)-6-oxo-3,4-dihydro-2H-pyrimido[2,1-b][1,3]thiazine-7-carbonitrile.
| Compound Name | 8-(2-cyclopropylpyrimidin-4-yl)-6-oxo-3,4-dihydro-2H-pyrimido[2,1-b][1,3]thiazine-7-carbonitrile |
|---|---|
| PubChem CID | 135181704 |
| Molecular Formula | C15H13N5OS |
| Molecular Weight | 311.37 g/mol |
| Exact Mass | 311.08 |
| IUPAC Name | 8-(2-cyclopropylpyrimidin-4-yl)-6-oxo-3,4-dihydro-2H-pyrimido[2,1-b][1,3]thiazine-7-carbonitrile |
| SMILES | N#Cc1c(-c2ccnc(C3CC3)n2)nc2n(c1=O)CCCS2 |
| InChI | InChI=1S/C15H13N5OS/c16-8-10-12(11-4-5-17-13(18-11)9-2-3-9)19-15-20(14(10)21)6-1-7-22-15/h4-5,9H,1-3,6-7H2 |
| InChIKey | ULWROLQLRBGBLF-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 84.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.37 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cyano_pyridone_B(27)', 'substructure': 'N/A'} |
|---|