C17H31NO2 — CID 135182095
8a-[2-(2,3-dipropylcyclopropyl)ethyl]-3,5,6,8-tetrahydro-2H-[1,3]oxazolo[2,3-c][1,4]oxazine (PubChem CID 135182095) has the molecular formula C17H31NO2 and a molecular weight of 281.44 g/mol. Its IUPAC name is 8a-[2-(2,3-dipropylcyclopropyl)ethyl]-3,5,6,8-tetrahydro-2H-[1,3]oxazolo[2,3-c][1,4]oxazine.
| Compound Name | 8a-[2-(2,3-dipropylcyclopropyl)ethyl]-3,5,6,8-tetrahydro-2H-[1,3]oxazolo[2,3-c][1,4]oxazine |
|---|---|
| PubChem CID | 135182095 |
| Molecular Formula | C17H31NO2 |
| Molecular Weight | 281.44 g/mol |
| Exact Mass | 281.24 |
| IUPAC Name | 8a-[2-(2,3-dipropylcyclopropyl)ethyl]-3,5,6,8-tetrahydro-2H-[1,3]oxazolo[2,3-c][1,4]oxazine |
| SMILES | CCCC1C(CCC)C1CCC12COCCN1CCO2 |
| InChI | InChI=1S/C17H31NO2/c1-3-5-14-15(6-4-2)16(14)7-8-17-13-19-11-9-18(17)10-12-20-17/h14-16H,3-13H2,1-2H3 |
| InChIKey | GGPNKWYHNQLPFU-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.44 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |