C16H24FN3O5S — CID 135182684
N-[[(7R)-5-(3-fluoro-4-morpholin-4-ylphenyl)-1,3,5-dioxazepan-7-yl]methyl]methanesulfonamide (PubChem CID 135182684) has the molecular formula C16H24FN3O5S and a molecular weight of 389.45 g/mol. Its IUPAC name is N-[[(7R)-5-(3-fluoro-4-morpholin-4-ylphenyl)-1,3,5-dioxazepan-7-yl]methyl]methanesulfonamide.
| Compound Name | N-[[(7R)-5-(3-fluoro-4-morpholin-4-ylphenyl)-1,3,5-dioxazepan-7-yl]methyl]methanesulfonamide |
|---|---|
| PubChem CID | 135182684 |
| Molecular Formula | C16H24FN3O5S |
| Molecular Weight | 389.45 g/mol |
| Exact Mass | 389.14 |
| IUPAC Name | N-[[(7R)-5-(3-fluoro-4-morpholin-4-ylphenyl)-1,3,5-dioxazepan-7-yl]methyl]methanesulfonamide |
| SMILES | CS(=O)(=O)NC[C@H]1CN(c2ccc(N3CCOCC3)c(F)c2)COCO1 |
| InChI | InChI=1S/C16H24FN3O5S/c1-26(21,22)18-9-14-10-20(11-24-12-25-14)13-2-3-16(15(17)8-13)19-4-6-23-7-5-19/h2-3,8,14,18H,4-7,9-12H2,1H3/t14-/m0/s1 |
| InChIKey | YAIBEVGYQSHTOC-AWEZNQCLSA-N |
| XLogP | 0.35 |
| TPSA | 80.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.45 |
| LogP ≤ 5 | 0.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|