C11H15F4NO — CID 135183216
(E)-2-methyl-6-(3,3,4,4-tetrafluoropyrrolidin-1-yl)hex-4-en-3-one (PubChem CID 135183216) has the molecular formula C11H15F4NO and a molecular weight of 253.24 g/mol. Its IUPAC name is (E)-2-methyl-6-(3,3,4,4-tetrafluoropyrrolidin-1-yl)hex-4-en-3-one.
| Compound Name | (E)-2-methyl-6-(3,3,4,4-tetrafluoropyrrolidin-1-yl)hex-4-en-3-one |
|---|---|
| PubChem CID | 135183216 |
| Molecular Formula | C11H15F4NO |
| Molecular Weight | 253.24 g/mol |
| Exact Mass | 253.11 |
| IUPAC Name | (E)-2-methyl-6-(3,3,4,4-tetrafluoropyrrolidin-1-yl)hex-4-en-3-one |
| SMILES | CC(C)C(=O)/C=C/CN1CC(F)(F)C(F)(F)C1 |
| InChI | InChI=1S/C11H15F4NO/c1-8(2)9(17)4-3-5-16-6-10(12,13)11(14,15)7-16/h3-4,8H,5-7H2,1-2H3/b4-3+ |
| InChIKey | XQVANRZAPUIXTB-ONEGZZNKSA-N |
| XLogP | 2.35 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.24 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|