C17H18N2O4 — CID 135183756
(2S)-3-(4-hydroxyphenyl)-2-[(3-methylphenyl)carbamoylamino]propanoic acid (PubChem CID 135183756) has the molecular formula C17H18N2O4 and a molecular weight of 314.34 g/mol. Its IUPAC name is (2S)-3-(4-hydroxyphenyl)-2-[(3-methylphenyl)carbamoylamino]propanoic acid.
| Compound Name | (2S)-3-(4-hydroxyphenyl)-2-[(3-methylphenyl)carbamoylamino]propanoic acid |
|---|---|
| PubChem CID | 135183756 |
| Molecular Formula | C17H18N2O4 |
| Molecular Weight | 314.34 g/mol |
| Exact Mass | 314.13 |
| IUPAC Name | (2S)-3-(4-hydroxyphenyl)-2-[(3-methylphenyl)carbamoylamino]propanoic acid |
| SMILES | Cc1cccc(NC(=O)N[C@@H](Cc2ccc(O)cc2)C(=O)O)c1 |
| InChI | InChI=1S/C17H18N2O4/c1-11-3-2-4-13(9-11)18-17(23)19-15(16(21)22)10-12-5-7-14(20)8-6-12/h2-9,15,20H,10H2,1H3,(H,21,22)(H2,18,19,23)/t15-/m0/s1 |
| InChIKey | CLOYFSDWXPPMTI-HNNXBMFYSA-N |
| XLogP | 2.52 |
| TPSA | 98.66 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.34 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |