C25H24FN3O5 — CID 135184512
(5Z)-2-(4-fluoroanilino)-3-(1-hydroxycyclohexyl)-4-oxo-5-(1H-pyrrolo[2,3-b]pyridin-3-ylmethylidene)oxolane-3-carboxylic acid (PubChem CID 135184512) has the molecular formula C25H24FN3O5 and a molecular weight of 465.48 g/mol. Its IUPAC name is (5Z)-2-(4-fluoroanilino)-3-(1-hydroxycyclohexyl)-4-oxo-5-(1H-pyrrolo[2,3-b]pyridin-3-ylmethylidene)oxolane-3-carboxylic acid.
| Compound Name | (5Z)-2-(4-fluoroanilino)-3-(1-hydroxycyclohexyl)-4-oxo-5-(1H-pyrrolo[2,3-b]pyridin-3-ylmethylidene)oxolane-3-carboxylic acid |
|---|---|
| PubChem CID | 135184512 |
| Molecular Formula | C25H24FN3O5 |
| Molecular Weight | 465.48 g/mol |
| Exact Mass | 465.17 |
| IUPAC Name | (5Z)-2-(4-fluoroanilino)-3-(1-hydroxycyclohexyl)-4-oxo-5-(1H-pyrrolo[2,3-b]pyridin-3-ylmethylidene)oxolane-3-carboxylic acid |
| SMILES | O=C(O)C1(C2(O)CCCCC2)C(=O)/C(=C/c2c[nH]c3ncccc23)OC1Nc1ccc(F)cc1 |
| InChI | InChI=1S/C25H24FN3O5/c26-16-6-8-17(9-7-16)29-22-25(23(31)32,24(33)10-2-1-3-11-24)20(30)19(34-22)13-15-14-28-21-18(15)5-4-12-27-21/h4-9,12-14,22,29,33H,1-3,10-11H2,(H,27,28)(H,31,32)/b19-13- |
| InChIKey | SMYWWJOVCFMKNH-UYRXBGFRSA-N |
| XLogP | 3.85 |
| TPSA | 124.54 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.48 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|