C16H18F5N3O — CID 135184829
(5S)-N-(2,2-difluoroethyl)-5-(2,2,2-trifluoroethyl)-1,10-diazatricyclo[6.4.1.04,13]trideca-2,4(13),7-triene-3-carboxamide (PubChem CID 135184829) has the molecular formula C16H18F5N3O and a molecular weight of 363.33 g/mol. Its IUPAC name is (5S)-N-(2,2-difluoroethyl)-5-(2,2,2-trifluoroethyl)-1,10-diazatricyclo[6.4.1.04,13]trideca-2,4(13),7-triene-3-carboxamide.
| Compound Name | (5S)-N-(2,2-difluoroethyl)-5-(2,2,2-trifluoroethyl)-1,10-diazatricyclo[6.4.1.04,13]trideca-2,4(13),7-triene-3-carboxamide |
|---|---|
| PubChem CID | 135184829 |
| Molecular Formula | C16H18F5N3O |
| Molecular Weight | 363.33 g/mol |
| Exact Mass | 363.14 |
| IUPAC Name | (5S)-N-(2,2-difluoroethyl)-5-(2,2,2-trifluoroethyl)-1,10-diazatricyclo[6.4.1.04,13]trideca-2,4(13),7-triene-3-carboxamide |
| SMILES | O=C(NCC(F)F)c1cn2c3c1[C@H](CC(F)(F)F)CC=C3CNCC2 |
| InChI | InChI=1S/C16H18F5N3O/c17-12(18)7-23-15(25)11-8-24-4-3-22-6-10-2-1-9(5-16(19,20)21)13(11)14(10)24/h2,8-9,12,22H,1,3-7H2,(H,23,25)/t9-/m0/s1 |
| InChIKey | XUGYJXALTLHDNI-VIFPVBQESA-N |
| XLogP | 2.91 |
| TPSA | 46.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.33 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |