About 2,8-diazaspiro[4.5]dec-1-en-1-amine;hydrochloride
2,8-diazaspiro[4.5]dec-1-en-1-amine;hydrochloride (PubChem CID 135185643) has the molecular formula C8H16ClN3
and a molecular weight of 189.69 g/mol. Its IUPAC name is 2,8-diazaspiro[4.5]dec-1-en-1-amine;hydrochloride.
Molecular Properties
| Compound Name | 2,8-diazaspiro[4.5]dec-1-en-1-amine;hydrochloride |
| PubChem CID | 135185643 |
| Molecular Formula | C8H16ClN3 |
| Molecular Weight | 189.69 g/mol |
| Exact Mass | 189.10 |
| IUPAC Name | 2,8-diazaspiro[4.5]dec-1-en-1-amine;hydrochloride |
| SMILES | Cl.NC1=NCCC12CCNCC2 |
| InChI | InChI=1S/C8H15N3.ClH/c9-7-8(3-6-11-7)1-4-10-5-2-8;/h10H,1-6H2,(H2,9,11);1H |
| InChIKey | LSKKDPPKXIVEDM-UHFFFAOYSA-N |
| XLogP | 0.54 |
| TPSA | 50.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 189.69 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2,8-diazaspiro[4.5]dec-1-en-1-amine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,8-diazaspiro[4.5]dec-1-en-1-amine;hydrochloride?
The IUPAC name of 2,8-diazaspiro[4.5]dec-1-en-1-amine;hydrochloride (CID 135185643) is 2,8-diazaspiro[4.5]dec-1-en-1-amine;hydrochloride.
What is the SMILES notation for 2,8-diazaspiro[4.5]dec-1-en-1-amine;hydrochloride?
The canonical SMILES for 2,8-diazaspiro[4.5]dec-1-en-1-amine;hydrochloride is Cl.NC1=NCCC12CCNCC2.
What is the InChIKey of 2,8-diazaspiro[4.5]dec-1-en-1-amine;hydrochloride?
The InChIKey is LSKKDPPKXIVEDM-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H15N3.ClH/c9-7-8(3-6-11-7)1-4-10-5-2-8;/h10H,1-6H2,(H2,9,11);1H.
What are the key properties of 2,8-diazaspiro[4.5]dec-1-en-1-amine;hydrochloride?
2,8-diazaspiro[4.5]dec-1-en-1-amine;hydrochloride has a molecular weight of 189.69 g/mol, XLogP of 0.54, 0 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2,8-diazaspiro[4.5]dec-1-en-1-amine;hydrochloride is sourced from PubChem (CID 135185643), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).