About 1-cyclopropyl-5,6-difluoro-2-(4-methylpyrimidin-5-yl)benzimidazole
1-cyclopropyl-5,6-difluoro-2-(4-methylpyrimidin-5-yl)benzimidazole (PubChem CID 135185771) has the molecular formula C15H12F2N4
and a molecular weight of 286.29 g/mol. Its IUPAC name is 1-cyclopropyl-5,6-difluoro-2-(4-methylpyrimidin-5-yl)benzimidazole.
Molecular Properties
| Compound Name | 1-cyclopropyl-5,6-difluoro-2-(4-methylpyrimidin-5-yl)benzimidazole |
| PubChem CID | 135185771 |
| Molecular Formula | C15H12F2N4 |
| Molecular Weight | 286.29 g/mol |
| Exact Mass | 286.10 |
| IUPAC Name | 1-cyclopropyl-5,6-difluoro-2-(4-methylpyrimidin-5-yl)benzimidazole |
| SMILES | Cc1ncncc1-c1nc2cc(F)c(F)cc2n1C1CC1 |
| InChI | InChI=1S/C15H12F2N4/c1-8-10(6-18-7-19-8)15-20-13-4-11(16)12(17)5-14(13)21(15)9-2-3-9/h4-7,9H,2-3H2,1H3 |
| InChIKey | ZQPGPFMINAZKHQ-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 286.29 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-cyclopropyl-5,6-difluoro-2-(4-methylpyrimidin-5-yl)benzimidazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-cyclopropyl-5,6-difluoro-2-(4-methylpyrimidin-5-yl)benzimidazole?
The IUPAC name of 1-cyclopropyl-5,6-difluoro-2-(4-methylpyrimidin-5-yl)benzimidazole (CID 135185771) is 1-cyclopropyl-5,6-difluoro-2-(4-methylpyrimidin-5-yl)benzimidazole.
What is the SMILES notation for 1-cyclopropyl-5,6-difluoro-2-(4-methylpyrimidin-5-yl)benzimidazole?
The canonical SMILES for 1-cyclopropyl-5,6-difluoro-2-(4-methylpyrimidin-5-yl)benzimidazole is Cc1ncncc1-c1nc2cc(F)c(F)cc2n1C1CC1.
What is the InChIKey of 1-cyclopropyl-5,6-difluoro-2-(4-methylpyrimidin-5-yl)benzimidazole?
The InChIKey is ZQPGPFMINAZKHQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H12F2N4/c1-8-10(6-18-7-19-8)15-20-13-4-11(16)12(17)5-14(13)21(15)9-2-3-9/h4-7,9H,2-3H2,1H3.
What are the key properties of 1-cyclopropyl-5,6-difluoro-2-(4-methylpyrimidin-5-yl)benzimidazole?
1-cyclopropyl-5,6-difluoro-2-(4-methylpyrimidin-5-yl)benzimidazole has a molecular weight of 286.29 g/mol, XLogP of 3.41, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-cyclopropyl-5,6-difluoro-2-(4-methylpyrimidin-5-yl)benzimidazole is sourced from PubChem (CID 135185771), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).