About 1-cyclopropyl-2-(4-ethylpyrimidin-5-yl)-5,6-difluorobenzimidazole
1-cyclopropyl-2-(4-ethylpyrimidin-5-yl)-5,6-difluorobenzimidazole (PubChem CID 135185789) has the molecular formula C16H14F2N4
and a molecular weight of 300.31 g/mol. Its IUPAC name is 1-cyclopropyl-2-(4-ethylpyrimidin-5-yl)-5,6-difluorobenzimidazole.
Molecular Properties
| Compound Name | 1-cyclopropyl-2-(4-ethylpyrimidin-5-yl)-5,6-difluorobenzimidazole |
| PubChem CID | 135185789 |
| Molecular Formula | C16H14F2N4 |
| Molecular Weight | 300.31 g/mol |
| Exact Mass | 300.12 |
| IUPAC Name | 1-cyclopropyl-2-(4-ethylpyrimidin-5-yl)-5,6-difluorobenzimidazole |
| SMILES | CCc1ncncc1-c1nc2cc(F)c(F)cc2n1C1CC1 |
| InChI | InChI=1S/C16H14F2N4/c1-2-13-10(7-19-8-20-13)16-21-14-5-11(17)12(18)6-15(14)22(16)9-3-4-9/h5-9H,2-4H2,1H3 |
| InChIKey | BPAROTGKULTHJV-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 300.31 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-cyclopropyl-2-(4-ethylpyrimidin-5-yl)-5,6-difluorobenzimidazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-cyclopropyl-2-(4-ethylpyrimidin-5-yl)-5,6-difluorobenzimidazole?
The IUPAC name of 1-cyclopropyl-2-(4-ethylpyrimidin-5-yl)-5,6-difluorobenzimidazole (CID 135185789) is 1-cyclopropyl-2-(4-ethylpyrimidin-5-yl)-5,6-difluorobenzimidazole.
What is the SMILES notation for 1-cyclopropyl-2-(4-ethylpyrimidin-5-yl)-5,6-difluorobenzimidazole?
The canonical SMILES for 1-cyclopropyl-2-(4-ethylpyrimidin-5-yl)-5,6-difluorobenzimidazole is CCc1ncncc1-c1nc2cc(F)c(F)cc2n1C1CC1.
What is the InChIKey of 1-cyclopropyl-2-(4-ethylpyrimidin-5-yl)-5,6-difluorobenzimidazole?
The InChIKey is BPAROTGKULTHJV-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H14F2N4/c1-2-13-10(7-19-8-20-13)16-21-14-5-11(17)12(18)6-15(14)22(16)9-3-4-9/h5-9H,2-4H2,1H3.
What are the key properties of 1-cyclopropyl-2-(4-ethylpyrimidin-5-yl)-5,6-difluorobenzimidazole?
1-cyclopropyl-2-(4-ethylpyrimidin-5-yl)-5,6-difluorobenzimidazole has a molecular weight of 300.31 g/mol, XLogP of 3.67, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-cyclopropyl-2-(4-ethylpyrimidin-5-yl)-5,6-difluorobenzimidazole is sourced from PubChem (CID 135185789), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).