C23H23ClN6O2 — CID 135185963
[3-[[6-(aminomethyl)pyrimidin-4-yl]oxymethyl]phenyl]-(5,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),10,12-tetraen-5-yl)methanone;hydrochloride (PubChem CID 135185963) has the molecular formula C23H23ClN6O2 and a molecular weight of 450.93 g/mol. Its IUPAC name is [3-[[6-(aminomethyl)pyrimidin-4-yl]oxymethyl]phenyl]-(5,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),10,12-tetraen-5-yl)methanone;hydrochloride.
| Compound Name | [3-[[6-(aminomethyl)pyrimidin-4-yl]oxymethyl]phenyl]-(5,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),10,12-tetraen-5-yl)methanone;hydrochloride |
|---|---|
| PubChem CID | 135185963 |
| Molecular Formula | C23H23ClN6O2 |
| Molecular Weight | 450.93 g/mol |
| Exact Mass | 450.16 |
| IUPAC Name | [3-[[6-(aminomethyl)pyrimidin-4-yl]oxymethyl]phenyl]-(5,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),10,12-tetraen-5-yl)methanone;hydrochloride |
| SMILES | Cl.NCc1cc(OCc2cccc(C(=O)N3CCc4c([nH]c5ncccc45)C3)c2)ncn1 |
| InChI | InChI=1S/C23H22N6O2.ClH/c24-11-17-10-21(27-14-26-17)31-13-15-3-1-4-16(9-15)23(30)29-8-6-18-19-5-2-7-25-22(19)28-20(18)12-29;/h1-5,7,9-10,14H,6,8,11-13,24H2,(H,25,28);1H |
| InChIKey | VRSVPXORETZNRB-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 110.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.93 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |