C16H11F2NS — CID 135186490
2-[(3,5-difluorophenyl)methylsulfanyl]quinoline (PubChem CID 135186490) has the molecular formula C16H11F2NS and a molecular weight of 287.33 g/mol. Its IUPAC name is 2-[(3,5-difluorophenyl)methylsulfanyl]quinoline.
| Compound Name | 2-[(3,5-difluorophenyl)methylsulfanyl]quinoline |
|---|---|
| PubChem CID | 135186490 |
| Molecular Formula | C16H11F2NS |
| Molecular Weight | 287.33 g/mol |
| Exact Mass | 287.06 |
| IUPAC Name | 2-[(3,5-difluorophenyl)methylsulfanyl]quinoline |
| SMILES | Fc1cc(F)cc(CSc2ccc3ccccc3n2)c1 |
| InChI | InChI=1S/C16H11F2NS/c17-13-7-11(8-14(18)9-13)10-20-16-6-5-12-3-1-2-4-15(12)19-16/h1-9H,10H2 |
| InChIKey | RLDIVUNSALYNAM-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.33 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |