About 6-chloro-N-[3,6-difluoro-5-[(E)-3-methoxyprop-1-enyl]-2-pyridinyl]-1H-indole-3-sulfonamide
6-chloro-N-[3,6-difluoro-5-[(E)-3-methoxyprop-1-enyl]-2-pyridinyl]-1H-indole-3-sulfonamide (PubChem CID 135187067) has the molecular formula C17H14ClF2N3O3S
and a molecular weight of 413.83 g/mol. Its IUPAC name is 6-chloro-N-[3,6-difluoro-5-[(E)-3-methoxyprop-1-enyl]-2-pyridinyl]-1H-indole-3-sulfonamide.
Molecular Properties
| Compound Name | 6-chloro-N-[3,6-difluoro-5-[(E)-3-methoxyprop-1-enyl]-2-pyridinyl]-1H-indole-3-sulfonamide |
| PubChem CID | 135187067 |
| Molecular Formula | C17H14ClF2N3O3S |
| Molecular Weight | 413.83 g/mol |
| Exact Mass | 413.04 |
| IUPAC Name | 6-chloro-N-[3,6-difluoro-5-[(E)-3-methoxyprop-1-enyl]-2-pyridinyl]-1H-indole-3-sulfonamide |
| SMILES | COC/C=C/c1cc(F)c(NS(=O)(=O)c2c[nH]c3cc(Cl)ccc23)nc1F |
| InChI | InChI=1S/C17H14ClF2N3O3S/c1-26-6-2-3-10-7-13(19)17(22-16(10)20)23-27(24,25)15-9-21-14-8-11(18)4-5-12(14)15/h2-5,7-9,21H,6H2,1H3,(H,22,23)/b3-2+ |
| InChIKey | QPMQAOROLLPQKQ-NSCUHMNNSA-N |
| XLogP | 3.95 |
| TPSA | 84.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 413.83 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|
Analyze 6-chloro-N-[3,6-difluoro-5-[(E)-3-methoxyprop-1-enyl]-2-pyridinyl]-1H-indole-3-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-chloro-N-[3,6-difluoro-5-[(E)-3-methoxyprop-1-enyl]-2-pyridinyl]-1H-indole-3-sulfonamide?
The IUPAC name of 6-chloro-N-[3,6-difluoro-5-[(E)-3-methoxyprop-1-enyl]-2-pyridinyl]-1H-indole-3-sulfonamide (CID 135187067) is 6-chloro-N-[3,6-difluoro-5-[(E)-3-methoxyprop-1-enyl]-2-pyridinyl]-1H-indole-3-sulfonamide.
What is the SMILES notation for 6-chloro-N-[3,6-difluoro-5-[(E)-3-methoxyprop-1-enyl]-2-pyridinyl]-1H-indole-3-sulfonamide?
The canonical SMILES for 6-chloro-N-[3,6-difluoro-5-[(E)-3-methoxyprop-1-enyl]-2-pyridinyl]-1H-indole-3-sulfonamide is COC/C=C/c1cc(F)c(NS(=O)(=O)c2c[nH]c3cc(Cl)ccc23)nc1F.
What is the InChIKey of 6-chloro-N-[3,6-difluoro-5-[(E)-3-methoxyprop-1-enyl]-2-pyridinyl]-1H-indole-3-sulfonamide?
The InChIKey is QPMQAOROLLPQKQ-NSCUHMNNSA-N. The full InChI is InChI=1S/C17H14ClF2N3O3S/c1-26-6-2-3-10-7-13(19)17(22-16(10)20)23-27(24,25)15-9-21-14-8-11(18)4-5-12(14)15/h2-5,7-9,21H,6H2,1H3,(H,22,23)/b3-2+.
What are the key properties of 6-chloro-N-[3,6-difluoro-5-[(E)-3-methoxyprop-1-enyl]-2-pyridinyl]-1H-indole-3-sulfonamide?
6-chloro-N-[3,6-difluoro-5-[(E)-3-methoxyprop-1-enyl]-2-pyridinyl]-1H-indole-3-sulfonamide has a molecular weight of 413.83 g/mol, XLogP of 3.95, 6 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-chloro-N-[3,6-difluoro-5-[(E)-3-methoxyprop-1-enyl]-2-pyridinyl]-1H-indole-3-sulfonamide is sourced from PubChem (CID 135187067), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).