About 6-chloro-N-(3,6-difluoro-5-methyl-2-pyridinyl)-7-(trifluoromethyl)-1H-indole-3-sulfonamide
6-chloro-N-(3,6-difluoro-5-methyl-2-pyridinyl)-7-(trifluoromethyl)-1H-indole-3-sulfonamide (PubChem CID 135187092) has the molecular formula C15H9ClF5N3O2S
and a molecular weight of 425.77 g/mol. Its IUPAC name is 6-chloro-N-(3,6-difluoro-5-methyl-2-pyridinyl)-7-(trifluoromethyl)-1H-indole-3-sulfonamide.
Molecular Properties
| Compound Name | 6-chloro-N-(3,6-difluoro-5-methyl-2-pyridinyl)-7-(trifluoromethyl)-1H-indole-3-sulfonamide |
| PubChem CID | 135187092 |
| Molecular Formula | C15H9ClF5N3O2S |
| Molecular Weight | 425.77 g/mol |
| Exact Mass | 425.00 |
| IUPAC Name | 6-chloro-N-(3,6-difluoro-5-methyl-2-pyridinyl)-7-(trifluoromethyl)-1H-indole-3-sulfonamide |
| SMILES | Cc1cc(F)c(NS(=O)(=O)c2c[nH]c3c(C(F)(F)F)c(Cl)ccc23)nc1F |
| InChI | InChI=1S/C15H9ClF5N3O2S/c1-6-4-9(17)14(23-13(6)18)24-27(25,26)10-5-22-12-7(10)2-3-8(16)11(12)15(19,20)21/h2-5,22H,1H3,(H,23,24) |
| InChIKey | GNWLZQDOPLPJKD-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 74.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 425.77 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|
Analyze 6-chloro-N-(3,6-difluoro-5-methyl-2-pyridinyl)-7-(trifluoromethyl)-1H-indole-3-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-chloro-N-(3,6-difluoro-5-methyl-2-pyridinyl)-7-(trifluoromethyl)-1H-indole-3-sulfonamide?
The IUPAC name of 6-chloro-N-(3,6-difluoro-5-methyl-2-pyridinyl)-7-(trifluoromethyl)-1H-indole-3-sulfonamide (CID 135187092) is 6-chloro-N-(3,6-difluoro-5-methyl-2-pyridinyl)-7-(trifluoromethyl)-1H-indole-3-sulfonamide.
What is the SMILES notation for 6-chloro-N-(3,6-difluoro-5-methyl-2-pyridinyl)-7-(trifluoromethyl)-1H-indole-3-sulfonamide?
The canonical SMILES for 6-chloro-N-(3,6-difluoro-5-methyl-2-pyridinyl)-7-(trifluoromethyl)-1H-indole-3-sulfonamide is Cc1cc(F)c(NS(=O)(=O)c2c[nH]c3c(C(F)(F)F)c(Cl)ccc23)nc1F.
What is the InChIKey of 6-chloro-N-(3,6-difluoro-5-methyl-2-pyridinyl)-7-(trifluoromethyl)-1H-indole-3-sulfonamide?
The InChIKey is GNWLZQDOPLPJKD-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H9ClF5N3O2S/c1-6-4-9(17)14(23-13(6)18)24-27(25,26)10-5-22-12-7(10)2-3-8(16)11(12)15(19,20)21/h2-5,22H,1H3,(H,23,24).
What are the key properties of 6-chloro-N-(3,6-difluoro-5-methyl-2-pyridinyl)-7-(trifluoromethyl)-1H-indole-3-sulfonamide?
6-chloro-N-(3,6-difluoro-5-methyl-2-pyridinyl)-7-(trifluoromethyl)-1H-indole-3-sulfonamide has a molecular weight of 425.77 g/mol, XLogP of 4.62, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-chloro-N-(3,6-difluoro-5-methyl-2-pyridinyl)-7-(trifluoromethyl)-1H-indole-3-sulfonamide is sourced from PubChem (CID 135187092), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).