C17H14ClF2N3O3S — CID 135187114
6-chloro-N-[5-[(E)-2-ethoxyethenyl]-3,6-difluoro-2-pyridinyl]-1H-indole-3-sulfonamide (PubChem CID 135187114) has the molecular formula C17H14ClF2N3O3S and a molecular weight of 413.83 g/mol. Its IUPAC name is 6-chloro-N-[5-[(E)-2-ethoxyethenyl]-3,6-difluoro-2-pyridinyl]-1H-indole-3-sulfonamide.
| Compound Name | 6-chloro-N-[5-[(E)-2-ethoxyethenyl]-3,6-difluoro-2-pyridinyl]-1H-indole-3-sulfonamide |
|---|---|
| PubChem CID | 135187114 |
| Molecular Formula | C17H14ClF2N3O3S |
| Molecular Weight | 413.83 g/mol |
| Exact Mass | 413.04 |
| IUPAC Name | 6-chloro-N-[5-[(E)-2-ethoxyethenyl]-3,6-difluoro-2-pyridinyl]-1H-indole-3-sulfonamide |
| SMILES | CCO/C=C/c1cc(F)c(NS(=O)(=O)c2c[nH]c3cc(Cl)ccc23)nc1F |
| InChI | InChI=1S/C17H14ClF2N3O3S/c1-2-26-6-5-10-7-13(19)17(22-16(10)20)23-27(24,25)15-9-21-14-8-11(18)3-4-12(14)15/h3-9,21H,2H2,1H3,(H,22,23)/b6-5+ |
| InChIKey | IEJXHENFRJWNQF-AATRIKPKSA-N |
| XLogP | 4.30 |
| TPSA | 84.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.83 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|