C15H21FN2O — CID 135187208
(4aS,8aR)-2-(2-fluoroethyl)-5,5,8a-trimethyl-6-oxo-1,3,4,4a-tetrahydroisoquinoline-7-carbonitrile (PubChem CID 135187208) has the molecular formula C15H21FN2O and a molecular weight of 264.34 g/mol. Its IUPAC name is (4aS,8aR)-2-(2-fluoroethyl)-5,5,8a-trimethyl-6-oxo-1,3,4,4a-tetrahydroisoquinoline-7-carbonitrile.
| Compound Name | (4aS,8aR)-2-(2-fluoroethyl)-5,5,8a-trimethyl-6-oxo-1,3,4,4a-tetrahydroisoquinoline-7-carbonitrile |
|---|---|
| PubChem CID | 135187208 |
| Molecular Formula | C15H21FN2O |
| Molecular Weight | 264.34 g/mol |
| Exact Mass | 264.16 |
| IUPAC Name | (4aS,8aR)-2-(2-fluoroethyl)-5,5,8a-trimethyl-6-oxo-1,3,4,4a-tetrahydroisoquinoline-7-carbonitrile |
| SMILES | CC1(C)C(=O)C(C#N)=C[C@@]2(C)CN(CCF)CC[C@H]12 |
| InChI | InChI=1S/C15H21FN2O/c1-14(2)12-4-6-18(7-5-16)10-15(12,3)8-11(9-17)13(14)19/h8,12H,4-7,10H2,1-3H3/t12-,15+/m1/s1 |
| InChIKey | STKIIOMZCHNRMI-DOMZBBRYSA-N |
| XLogP | 2.34 |
| TPSA | 44.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.34 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |