C15H19F3N2O — CID 135187610
(4aS,8aR)-5,5,8a-trimethyl-6-oxo-2-(2,2,2-trifluoroethyl)-1,3,4,4a-tetrahydroisoquinoline-7-carbonitrile (PubChem CID 135187610) has the molecular formula C15H19F3N2O and a molecular weight of 300.32 g/mol. Its IUPAC name is (4aS,8aR)-5,5,8a-trimethyl-6-oxo-2-(2,2,2-trifluoroethyl)-1,3,4,4a-tetrahydroisoquinoline-7-carbonitrile.
| Compound Name | (4aS,8aR)-5,5,8a-trimethyl-6-oxo-2-(2,2,2-trifluoroethyl)-1,3,4,4a-tetrahydroisoquinoline-7-carbonitrile |
|---|---|
| PubChem CID | 135187610 |
| Molecular Formula | C15H19F3N2O |
| Molecular Weight | 300.32 g/mol |
| Exact Mass | 300.14 |
| IUPAC Name | (4aS,8aR)-5,5,8a-trimethyl-6-oxo-2-(2,2,2-trifluoroethyl)-1,3,4,4a-tetrahydroisoquinoline-7-carbonitrile |
| SMILES | CC1(C)C(=O)C(C#N)=C[C@@]2(C)CN(CC(F)(F)F)CC[C@H]12 |
| InChI | InChI=1S/C15H19F3N2O/c1-13(2)11-4-5-20(9-15(16,17)18)8-14(11,3)6-10(7-19)12(13)21/h6,11H,4-5,8-9H2,1-3H3/t11-,14+/m1/s1 |
| InChIKey | DXQRFCSZTDNYBK-RISCZKNCSA-N |
| XLogP | 2.94 |
| TPSA | 44.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.32 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |