C28H25N3O5 — CID 135187678
4-methoxy-N-[[3-[(4-nitrophenyl)methoxy]phenyl]methyl]-N-(pyridin-4-ylmethyl)benzamide (PubChem CID 135187678) has the molecular formula C28H25N3O5 and a molecular weight of 483.52 g/mol. Its IUPAC name is 4-methoxy-N-[[3-[(4-nitrophenyl)methoxy]phenyl]methyl]-N-(pyridin-4-ylmethyl)benzamide.
| Compound Name | 4-methoxy-N-[[3-[(4-nitrophenyl)methoxy]phenyl]methyl]-N-(pyridin-4-ylmethyl)benzamide |
|---|---|
| PubChem CID | 135187678 |
| Molecular Formula | C28H25N3O5 |
| Molecular Weight | 483.52 g/mol |
| Exact Mass | 483.18 |
| IUPAC Name | 4-methoxy-N-[[3-[(4-nitrophenyl)methoxy]phenyl]methyl]-N-(pyridin-4-ylmethyl)benzamide |
| SMILES | COc1ccc(C(=O)N(Cc2ccncc2)Cc2cccc(OCc3ccc([N+](=O)[O-])cc3)c2)cc1 |
| InChI | InChI=1S/C28H25N3O5/c1-35-26-11-7-24(8-12-26)28(32)30(18-21-13-15-29-16-14-21)19-23-3-2-4-27(17-23)36-20-22-5-9-25(10-6-22)31(33)34/h2-17H,18-20H2,1H3 |
| InChIKey | NXNMGQAIPQPWEJ-UHFFFAOYSA-N |
| XLogP | 5.42 |
| TPSA | 94.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.52 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|